About CID 58621314
CID 58621314 (PubChem CID 58621314) has the molecular formula C49H50IrN3O4
and a molecular weight of 937.17 g/mol.
Molecular Properties
| Compound Name | CID 58621314 |
| PubChem CID | 58621314 |
| Molecular Formula | C49H50IrN3O4 |
| Molecular Weight | 937.17 g/mol |
| Exact Mass | 937.34 |
| IUPAC Name | — |
| SMILES | [Ir+3].[c-]1cc2ccc1-c1cccc(n1)-c1[c-]cc(cc1)OCCCCCCCCOc1cccnc1-c1[c-]c(ccc1)-c1ncccc1OCCCCCCCCO2 |
| InChI | InChI=1S/C49H50N3O4.Ir/c1-3-7-11-35-55-46-21-15-31-50-48(46)40-17-13-18-41(37-40)49-47(22-16-32-51-49)56-36-12-8-4-2-6-10-34-54-43-29-25-39(26-30-43)45-20-14-19-44(52-45)38-23-27-42(28-24-38)53-33-9-5-1;/h13-23,25,27-32H,1-12,33-36H2;/q-3;+3 |
| InChIKey | JPVAOCPLOBWBEU-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 937.17 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58621314 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58621314?
The IUPAC name of CID 58621314 (CID 58621314) is not available.
What is the SMILES notation for CID 58621314?
The canonical SMILES for CID 58621314 is [Ir+3].[c-]1cc2ccc1-c1cccc(n1)-c1[c-]cc(cc1)OCCCCCCCCOc1cccnc1-c1[c-]c(ccc1)-c1ncccc1OCCCCCCCCO2.
What is the InChIKey of CID 58621314?
The InChIKey is JPVAOCPLOBWBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H50N3O4.Ir/c1-3-7-11-35-55-46-21-15-31-50-48(46)40-17-13-18-41(37-40)49-47(22-16-32-51-49)56-36-12-8-4-2-6-10-34-54-43-29-25-39(26-30-43)45-20-14-19-44(52-45)38-23-27-42(28-24-38)53-33-9-5-1;/h13-23,25,27-32H,1-12,33-36H2;/q-3;+3.
What are the key properties of CID 58621314?
CID 58621314 has a molecular weight of 937.17 g/mol, XLogP of 11.85, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58621314 is sourced from PubChem (CID 58621314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).