About CID 58621526
CID 58621526 (PubChem CID 58621526) has the molecular formula C47H50N5O4Re-
and a molecular weight of 935.15 g/mol.
Molecular Properties
| Compound Name | CID 58621526 |
| PubChem CID | 58621526 |
| Molecular Formula | C47H50N5O4Re- |
| Molecular Weight | 935.15 g/mol |
| Exact Mass | 935.34 |
| IUPAC Name | — |
| SMILES | [Re].[c-]1c(-c2ccccn2)c2cc(c1-c1ccccn1)OCCCCCCCCOc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)OCCCCCCCCO2 |
| InChI | InChI=1S/C47H50N5O4.Re/c1-3-7-15-30-55-46-33-47(39(41-19-10-12-27-49-41)32-38(46)40-18-9-11-26-48-40)56-31-16-8-4-2-6-14-29-54-37-23-25-43(51-35-37)45-21-17-20-44(52-45)42-24-22-36(34-50-42)53-28-13-5-1;/h9-12,17-27,33-35H,1-8,13-16,28-31H2;/q-1; |
| InChIKey | ZHYNKZICQGSYFR-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 101.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 935.15 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58621526 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58621526?
The IUPAC name of CID 58621526 (CID 58621526) is not available.
What is the SMILES notation for CID 58621526?
The canonical SMILES for CID 58621526 is [Re].[c-]1c(-c2ccccn2)c2cc(c1-c1ccccn1)OCCCCCCCCOc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)OCCCCCCCCO2.
What is the InChIKey of CID 58621526?
The InChIKey is ZHYNKZICQGSYFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H50N5O4.Re/c1-3-7-15-30-55-46-33-47(39(41-19-10-12-27-49-41)32-38(46)40-18-9-11-26-48-40)56-31-16-8-4-2-6-14-29-54-37-23-25-43(51-35-37)45-21-17-20-44(52-45)42-24-22-36(34-50-42)53-28-13-5-1;/h9-12,17-27,33-35H,1-8,13-16,28-31H2;/q-1;.
What are the key properties of CID 58621526?
CID 58621526 has a molecular weight of 935.15 g/mol, XLogP of 11.04, 2 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58621526 is sourced from PubChem (CID 58621526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).