About CID 58621543
CID 58621543 (PubChem CID 58621543) has the molecular formula C48H47F5N5O4Re-
and a molecular weight of 1039.13 g/mol.
Molecular Properties
| Compound Name | CID 58621543 |
| PubChem CID | 58621543 |
| Molecular Formula | C48H47F5N5O4Re- |
| Molecular Weight | 1039.13 g/mol |
| Exact Mass | 1039.31 |
| IUPAC Name | — |
| SMILES | Fc1c2[c-]c(c(F)c1C(F)(F)F)-c1ncccc1OCCCCCCCCOc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)OCCCCCCCCOc1cccnc1-2.[Re] |
| InChI | InChI=1S/C48H47F5N5O4.Re/c49-44-35-30-36(45(50)43(44)48(51,52)53)47-42(19-15-25-55-47)62-29-12-8-4-2-6-10-27-60-34-21-23-38(57-32-34)40-17-13-16-39(58-40)37-22-20-33(31-56-37)59-26-9-5-1-3-7-11-28-61-41-18-14-24-54-46(35)41;/h13-25,31-32H,1-12,26-29H2;/q-1; |
| InChIKey | JZRKDYYFKPPVBA-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 101.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1039.13 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58621543 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58621543?
The IUPAC name of CID 58621543 (CID 58621543) is not available.
What is the SMILES notation for CID 58621543?
The canonical SMILES for CID 58621543 is Fc1c2[c-]c(c(F)c1C(F)(F)F)-c1ncccc1OCCCCCCCCOc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)OCCCCCCCCOc1cccnc1-2.[Re].
What is the InChIKey of CID 58621543?
The InChIKey is JZRKDYYFKPPVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H47F5N5O4.Re/c49-44-35-30-36(45(50)43(44)48(51,52)53)47-42(19-15-25-55-47)62-29-12-8-4-2-6-10-27-60-34-21-23-38(57-32-34)40-17-13-16-39(58-40)37-22-20-33(31-56-37)59-26-9-5-1-3-7-11-28-61-41-18-14-24-54-46(35)41;/h13-25,31-32H,1-12,26-29H2;/q-1;.
What are the key properties of CID 58621543?
CID 58621543 has a molecular weight of 1039.13 g/mol, XLogP of 12.33, 0 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58621543 is sourced from PubChem (CID 58621543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).