About 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium
1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium (PubChem CID 58621579) has the molecular formula C11H9F2IrN2-
and a molecular weight of 399.42 g/mol. Its IUPAC name is 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium.
Molecular Properties
| Compound Name | 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium |
| PubChem CID | 58621579 |
| Molecular Formula | C11H9F2IrN2- |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium |
| SMILES | CCc1[c-]c(-n2cccn2)c(F)cc1F.[Ir] |
| InChI | InChI=1S/C11H9F2N2.Ir/c1-2-8-6-11(10(13)7-9(8)12)15-5-3-4-14-15;/h3-5,7H,2H2,1H3;/q-1; |
| InChIKey | SGWSKKBAJVSDDF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium?
The IUPAC name of 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium (CID 58621579) is 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium.
What is the SMILES notation for 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium?
The canonical SMILES for 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium is CCc1[c-]c(-n2cccn2)c(F)cc1F.[Ir].
What is the InChIKey of 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium?
The InChIKey is SGWSKKBAJVSDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2N2.Ir/c1-2-8-6-11(10(13)7-9(8)12)15-5-3-4-14-15;/h3-5,7H,2H2,1H3;/q-1;.
What are the key properties of 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium?
1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium has a molecular weight of 399.42 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-2,4-difluorobenzene-6-id-1-yl)pyrazole;iridium is sourced from PubChem (CID 58621579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).