C14H19F3O2 — CID 58621728
4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)tricyclo[6.2.1.02,7]undec-9-en-3-ol (PubChem CID 58621728) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)tricyclo[6.2.1.02,7]undec-9-en-3-ol.
| Compound Name | 4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)tricyclo[6.2.1.02,7]undec-9-en-3-ol |
|---|---|
| PubChem CID | 58621728 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)tricyclo[6.2.1.02,7]undec-9-en-3-ol |
| SMILES | CC(O)(C1CCC2C3C=CC(C3)C2C1O)C(F)(F)F |
| InChI | InChI=1S/C14H19F3O2/c1-13(19,14(15,16)17)10-5-4-9-7-2-3-8(6-7)11(9)12(10)18/h2-3,7-12,18-19H,4-6H2,1H3 |
| InChIKey | PUGBONRUSGSMJY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|