C18H29F3O3 — CID 58621738
4-[2-(ethoxymethoxy)-1,1,1-trifluoropropan-2-yl]-8,9-dimethyltricyclo[5.2.1.02,6]decan-3-ol (PubChem CID 58621738) has the molecular formula C18H29F3O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[2-(ethoxymethoxy)-1,1,1-trifluoropropan-2-yl]-8,9-dimethyltricyclo[5.2.1.02,6]decan-3-ol.
| Compound Name | 4-[2-(ethoxymethoxy)-1,1,1-trifluoropropan-2-yl]-8,9-dimethyltricyclo[5.2.1.02,6]decan-3-ol |
|---|---|
| PubChem CID | 58621738 |
| Molecular Formula | C18H29F3O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 4-[2-(ethoxymethoxy)-1,1,1-trifluoropropan-2-yl]-8,9-dimethyltricyclo[5.2.1.02,6]decan-3-ol |
| SMILES | CCOCOC(C)(C1CC2C3CC(C(C)C3C)C2C1O)C(F)(F)F |
| InChI | InChI=1S/C18H29F3O3/c1-5-23-8-24-17(4,18(19,20)21)14-7-13-11-6-12(10(3)9(11)2)15(13)16(14)22/h9-16,22H,5-8H2,1-4H3 |
| InChIKey | HIWRYZZMDZNLNY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|