C34H34N2O6 — CID 58622071
[[(4-methylphenyl)-(4-nitrophenyl)methylidene]amino] 2-[(13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]acetate (PubChem CID 58622071) has the molecular formula C34H34N2O6 and a molecular weight of 566.65 g/mol. Its IUPAC name is [[(4-methylphenyl)-(4-nitrophenyl)methylidene]amino] 2-[(13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]acetate.
| Compound Name | [[(4-methylphenyl)-(4-nitrophenyl)methylidene]amino] 2-[(13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]acetate |
|---|---|
| PubChem CID | 58622071 |
| Molecular Formula | C34H34N2O6 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | [[(4-methylphenyl)-(4-nitrophenyl)methylidene]amino] 2-[(13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]acetate |
| SMILES | Cc1ccc(C(=NOC(=O)CC2CC3C4CCc5cc(O)ccc5C4CC[C@]3(C)C2=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C34H34N2O6/c1-20-3-5-21(6-4-20)32(22-7-10-25(11-8-22)36(40)41)35-42-31(38)19-24-18-30-29-13-9-23-17-26(37)12-14-27(23)28(29)15-16-34(30,2)33(24)39/h3-8,10-12,14,17,24,28-30,37H,9,13,15-16,18-19H2,1-2H3/t24?,28?,29?,30?,34-/m0/s1 |
| InChIKey | GECWNIJDUWYPLL-KZIMYOLGSA-N |
| XLogP | 6.65 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|