C30H35N3O5 — CID 58622205
N-[[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]methyl]-7-methoxy-2,2-dimethyl-N-[(2-oxidoisoquinolin-2-ium-3-yl)methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 58622205) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]methyl]-7-methoxy-2,2-dimethyl-N-[(2-oxidoisoquinolin-2-ium-3-yl)methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]methyl]-7-methoxy-2,2-dimethyl-N-[(2-oxidoisoquinolin-2-ium-3-yl)methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 58622205 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-[[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]methyl]-7-methoxy-2,2-dimethyl-N-[(2-oxidoisoquinolin-2-ium-3-yl)methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cc(C(=O)N(Cc2cc3ccccc3c[n+]2[O-])C[C@@H]2C[C@@H]3CCCC[C@@H]3N2)cc2c1OC(C)(C)O2 |
| InChI | InChI=1S/C30H35N3O5/c1-30(2)37-27-15-22(14-26(36-3)28(27)38-30)29(34)32(17-23-12-20-9-6-7-11-25(20)31-23)18-24-13-19-8-4-5-10-21(19)16-33(24)35/h4-5,8,10,13-16,20,23,25,31H,6-7,9,11-12,17-18H2,1-3H3/t20-,23-,25-/m0/s1 |
| InChIKey | NZTLNEZEMMTBQE-OPHFCASCSA-N |
| XLogP | 4.55 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|