C19H13NOS — CID 58622481
4-(4-phenylphenoxy)thieno[2,3-c]pyridine (PubChem CID 58622481) has the molecular formula C19H13NOS and a molecular weight of 303.39 g/mol. Its IUPAC name is 4-(4-phenylphenoxy)thieno[2,3-c]pyridine.
| Compound Name | 4-(4-phenylphenoxy)thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 58622481 |
| Molecular Formula | C19H13NOS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-(4-phenylphenoxy)thieno[2,3-c]pyridine |
| SMILES | c1ccc(-c2ccc(Oc3cncc4sccc34)cc2)cc1 |
| InChI | InChI=1S/C19H13NOS/c1-2-4-14(5-3-1)15-6-8-16(9-7-15)21-18-12-20-13-19-17(18)10-11-22-19/h1-13H |
| InChIKey | QDCVIVROAYXPFD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |