About 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone
1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone (PubChem CID 58622541) has the molecular formula C9H6BrNOS
and a molecular weight of 256.12 g/mol. Its IUPAC name is 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone |
| PubChem CID | 58622541 |
| Molecular Formula | C9H6BrNOS |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 254.94 |
| IUPAC Name | 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone |
| SMILES | CC(=O)c1cc2c(Br)cncc2s1 |
| InChI | InChI=1S/C9H6BrNOS/c1-5(12)8-2-6-7(10)3-11-4-9(6)13-8/h2-4H,1H3 |
| InChIKey | IGTXCVJOPXCBEM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone?
The IUPAC name of 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone (CID 58622541) is 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone.
What is the SMILES notation for 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone?
The canonical SMILES for 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone is CC(=O)c1cc2c(Br)cncc2s1.
What is the InChIKey of 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone?
The InChIKey is IGTXCVJOPXCBEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNOS/c1-5(12)8-2-6-7(10)3-11-4-9(6)13-8/h2-4H,1H3.
What are the key properties of 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone?
1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone has a molecular weight of 256.12 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromothieno[2,3-c]pyridin-2-yl)ethanone is sourced from PubChem (CID 58622541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).