C20H15N3OS — CID 58622591
4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide (PubChem CID 58622591) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide.
| Compound Name | 4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 58622591 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(Oc3ccc(-c4ccccc4)cc3)cncc2s1 |
| InChI | InChI=1S/C20H15N3OS/c21-20(22)18-10-16-17(11-23-12-19(16)25-18)24-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H,(H3,21,22) |
| InChIKey | IPYVCHJCXHTBPA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|