About carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium
carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium (PubChem CID 58622628) has the molecular formula C13H9ClN2SY-2
and a molecular weight of 349.66 g/mol. Its IUPAC name is carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium.
Molecular Properties
| Compound Name | carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium |
| PubChem CID | 58622628 |
| Molecular Formula | C13H9ClN2SY-2 |
| Molecular Weight | 349.66 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium |
| SMILES | Clc1nncc2s[c-]c(-c3ccccc3)c12.[CH3-].[Y] |
| InChI | InChI=1S/C12H6ClN2S.CH3.Y/c13-12-11-9(8-4-2-1-3-5-8)7-16-10(11)6-14-15-12;;/h1-6H;1H3;/q2*-1; |
| InChIKey | GVASGARDDGWEPB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium?
The IUPAC name of carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium (CID 58622628) is carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium.
What is the SMILES notation for carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium?
The canonical SMILES for carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium is Clc1nncc2s[c-]c(-c3ccccc3)c12.[CH3-].[Y].
What is the InChIKey of carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium?
The InChIKey is GVASGARDDGWEPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6ClN2S.CH3.Y/c13-12-11-9(8-4-2-1-3-5-8)7-16-10(11)6-14-15-12;;/h1-6H;1H3;/q2*-1;.
What are the key properties of carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium?
carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium has a molecular weight of 349.66 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;4-chloro-3-phenyl-2H-thieno[2,3-d]pyridazin-2-ide;yttrium is sourced from PubChem (CID 58622628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).