About 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea
1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea (PubChem CID 58622669) has the molecular formula C22H20N4OS
and a molecular weight of 388.50 g/mol. Its IUPAC name is 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea.
Molecular Properties
| Compound Name | 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea |
| PubChem CID | 58622669 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea |
| SMILES | CN(C)C(=O)Nc1cc2c(Nc3ccc(-c4ccccc4)cc3)cncc2s1 |
| InChI | InChI=1S/C22H20N4OS/c1-26(2)22(27)25-21-12-18-19(13-23-14-20(18)28-21)24-17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-14,24H,1-2H3,(H,25,27) |
| InChIKey | ZOAOYANNCXLEET-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea?
The IUPAC name of 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea (CID 58622669) is 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea.
What is the SMILES notation for 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea?
The canonical SMILES for 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea is CN(C)C(=O)Nc1cc2c(Nc3ccc(-c4ccccc4)cc3)cncc2s1.
What is the InChIKey of 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea?
The InChIKey is ZOAOYANNCXLEET-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4OS/c1-26(2)22(27)25-21-12-18-19(13-23-14-20(18)28-21)24-17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-14,24H,1-2H3,(H,25,27).
What are the key properties of 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea?
1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea has a molecular weight of 388.50 g/mol, XLogP of 5.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3-[4-(4-phenylanilino)thieno[2,3-c]pyridin-2-yl]urea is sourced from PubChem (CID 58622669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).