C19H19Cl2F3N4O3S — CID 58622952
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[5-(4-chlorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone (PubChem CID 58622952) has the molecular formula C19H19Cl2F3N4O3S and a molecular weight of 511.35 g/mol. Its IUPAC name is 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[5-(4-chlorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone.
| Compound Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[5-(4-chlorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 58622952 |
| Molecular Formula | C19H19Cl2F3N4O3S |
| Molecular Weight | 511.35 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[5-(4-chlorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethanone |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CC(=O)N1CC2CN(S(=O)(=O)c3ccc(Cl)cc3)CC2C1 |
| InChI | InChI=1S/C19H19Cl2F3N4O3S/c1-11-17(21)18(19(22,23)24)25-28(11)10-16(29)26-6-12-8-27(9-13(12)7-26)32(30,31)15-4-2-14(20)3-5-15/h2-5,12-13H,6-10H2,1H3 |
| InChIKey | WPUPIPXMEFMTCD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |