About 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid
2-pyrazolo[5,4-b]pyridin-1-ylacetic acid (PubChem CID 58622961) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid.
Molecular Properties
| Compound Name | 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid |
| PubChem CID | 58622961 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid |
| SMILES | O=C(O)Cn1ncc2cccnc21 |
| InChI | InChI=1S/C8H7N3O2/c12-7(13)5-11-8-6(4-10-11)2-1-3-9-8/h1-4H,5H2,(H,12,13) |
| InChIKey | HNDSESMBMGSAFL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid?
The IUPAC name of 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid (CID 58622961) is 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid.
What is the SMILES notation for 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid?
The canonical SMILES for 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid is O=C(O)Cn1ncc2cccnc21.
What is the InChIKey of 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid?
The InChIKey is HNDSESMBMGSAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c12-7(13)5-11-8-6(4-10-11)2-1-3-9-8/h1-4H,5H2,(H,12,13).
What are the key properties of 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid?
2-pyrazolo[5,4-b]pyridin-1-ylacetic acid has a molecular weight of 177.16 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid is sourced from PubChem (CID 58622961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).