2-pyrazolo[5,4-b]pyridin-1-ylacetic acid

C8H7N3O2 — CID 58622961

IUPAC2-pyrazolo[5,4-b]pyridin-1-ylacetic acid
SMILESO=C(O)Cn1ncc2cccnc21
InChIInChI=1S/C8H7N3O2/c12-7(13)5-11-8-6(4-10-11)2-1-3-9-8/h1-4H,5H2,(H,12,13)
InChIKeyHNDSESMBMGSAFL-UHFFFAOYSA-N
MW177.16 g/mol
LogP0.52
Rot. Bonds2

About 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid

2-pyrazolo[5,4-b]pyridin-1-ylacetic acid (PubChem CID 58622961) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid.

Molecular Properties

Compound Name2-pyrazolo[5,4-b]pyridin-1-ylacetic acid
PubChem CID58622961
Molecular FormulaC8H7N3O2
Molecular Weight177.16 g/mol
Exact Mass177.05
IUPAC Name2-pyrazolo[5,4-b]pyridin-1-ylacetic acid
SMILESO=C(O)Cn1ncc2cccnc21
InChIInChI=1S/C8H7N3O2/c12-7(13)5-11-8-6(4-10-11)2-1-3-9-8/h1-4H,5H2,(H,12,13)
InChIKeyHNDSESMBMGSAFL-UHFFFAOYSA-N
XLogP0.52
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.16
LogP ≤ 50.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid?
The IUPAC name of 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid (CID 58622961) is 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid.
What is the SMILES notation for 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid?
The canonical SMILES for 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid is O=C(O)Cn1ncc2cccnc21.
What is the InChIKey of 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid?
The InChIKey is HNDSESMBMGSAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c12-7(13)5-11-8-6(4-10-11)2-1-3-9-8/h1-4H,5H2,(H,12,13).
What are the key properties of 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid?
2-pyrazolo[5,4-b]pyridin-1-ylacetic acid has a molecular weight of 177.16 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazolo[5,4-b]pyridin-1-ylacetic acid is sourced from PubChem (CID 58622961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).