C31H41F3N2O5S — CID 58623043
1-tert-butyl-N-(oxan-2-yloxy)-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 58623043) has the molecular formula C31H41F3N2O5S and a molecular weight of 610.74 g/mol. Its IUPAC name is 1-tert-butyl-N-(oxan-2-yloxy)-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-tert-butyl-N-(oxan-2-yloxy)-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623043 |
| Molecular Formula | C31H41F3N2O5S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | 1-tert-butyl-N-(oxan-2-yloxy)-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)(C)N1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H41F3N2O5S/c1-29(2,3)36-20-18-30(19-21-36,28(37)35-41-27-8-4-5-22-40-27)42(38,39)26-15-13-25(14-16-26)24-11-9-23(10-12-24)7-6-17-31(32,33)34/h9-16,27H,4-8,17-22H2,1-3H3,(H,35,37) |
| InChIKey | ACXYYUWVUUWXDD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|