C31H34F5N3O4S — CID 58623044
tert-butyl 1-benzyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623044) has the molecular formula C31H34F5N3O4S and a molecular weight of 639.69 g/mol. Its IUPAC name is tert-butyl 1-benzyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-benzyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623044 |
| Molecular Formula | C31H34F5N3O4S |
| Molecular Weight | 639.69 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | tert-butyl 1-benzyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H34F5N3O4S/c1-28(2,3)43-27(40)29(15-17-39(18-16-29)21-22-7-5-4-6-8-22)44(41,42)25-11-9-23(10-12-25)26-20-37-24(19-38-26)13-14-30(32,33)31(34,35)36/h4-12,19-20H,13-18,21H2,1-3H3 |
| InChIKey | MIAFIUMPEGRVEX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.69 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|