C25H29F5N2O4S — CID 58623046
tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623046) has the molecular formula C25H29F5N2O4S and a molecular weight of 548.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623046 |
| Molecular Formula | C25H29F5N2O4S |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCNCC1 |
| InChI | InChI=1S/C25H29F5N2O4S/c1-22(2,3)36-21(33)23(12-14-31-15-13-23)37(34,35)19-7-5-18(6-8-19)20-9-4-17(16-32-20)10-11-24(26,27)25(28,29)30/h4-9,16,31H,10-15H2,1-3H3 |
| InChIKey | YMFHDMBPTYNIFI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|