C26H31F3N2O6S — CID 58623051
N-(oxan-2-yloxy)-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 58623051) has the molecular formula C26H31F3N2O6S and a molecular weight of 556.60 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 58623051 |
| Molecular Formula | C26H31F3N2O6S |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | N-(oxan-2-yloxy)-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cn3)cc2)CCOCC1 |
| InChI | InChI=1S/C26H31F3N2O6S/c27-26(28,29)12-3-4-19-6-11-22(30-18-19)20-7-9-21(10-8-20)38(33,34)25(13-16-35-17-14-25)24(32)31-37-23-5-1-2-15-36-23/h6-11,18,23H,1-5,12-17H2,(H,31,32) |
| InChIKey | TWMBUZAKOWCTJD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|