C26H29F5O5S — CID 58623053
tert-butyl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate (PubChem CID 58623053) has the molecular formula C26H29F5O5S and a molecular weight of 548.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 58623053 |
| Molecular Formula | C26H29F5O5S |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | tert-butyl 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C26H29F5O5S/c1-23(2,3)36-22(32)24(14-16-35-17-15-24)37(33,34)21-10-8-20(9-11-21)19-6-4-18(5-7-19)12-13-25(27,28)26(29,30)31/h4-11H,12-17H2,1-3H3 |
| InChIKey | YRBJNGMUHAAXCO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|