C18H27BO6S — CID 58623061
tert-butyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylacetate (PubChem CID 58623061) has the molecular formula C18H27BO6S and a molecular weight of 382.29 g/mol. Its IUPAC name is tert-butyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylacetate.
| Compound Name | tert-butyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 58623061 |
| Molecular Formula | C18H27BO6S |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | tert-butyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylacetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H27BO6S/c1-16(2,3)23-15(20)12-26(21,22)14-10-8-13(9-11-14)19-24-17(4,5)18(6,7)25-19/h8-11H,12H2,1-7H3 |
| InChIKey | QPDMHUYCKAHPSH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|