C25H26F5NO4S — CID 58623069
1-cyclopropyl-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylic acid (PubChem CID 58623069) has the molecular formula C25H26F5NO4S and a molecular weight of 531.54 g/mol. Its IUPAC name is 1-cyclopropyl-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 1-cyclopropyl-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58623069 |
| Molecular Formula | C25H26F5NO4S |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 1-cyclopropyl-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C25H26F5NO4S/c26-24(27,25(28,29)30)12-11-17-1-3-18(4-2-17)19-5-9-21(10-6-19)36(34,35)23(22(32)33)13-15-31(16-14-23)20-7-8-20/h1-6,9-10,20H,7-8,11-16H2,(H,32,33) |
| InChIKey | HAHCXRUZYXYZRD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|