C24H27F4NO5S — CID 58623072
tert-butyl 4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623072) has the molecular formula C24H27F4NO5S and a molecular weight of 517.54 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623072 |
| Molecular Formula | C24H27F4NO5S |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | tert-butyl 4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)cc2)CCNCC1 |
| InChI | InChI=1S/C24H27F4NO5S/c1-22(2,3)34-21(30)23(12-14-29-15-13-23)35(31,32)19-10-6-17(7-11-19)16-4-8-18(9-5-16)33-24(27,28)20(25)26/h4-11,20,29H,12-15H2,1-3H3 |
| InChIKey | PIIPLZHRRUNMJZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|