C27H32F3NO6S — CID 58623075
N-(oxan-2-yloxy)-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 58623075) has the molecular formula C27H32F3NO6S and a molecular weight of 555.62 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 58623075 |
| Molecular Formula | C27H32F3NO6S |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | N-(oxan-2-yloxy)-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C27H32F3NO6S/c28-27(29,30)14-3-4-20-6-8-21(9-7-20)22-10-12-23(13-11-22)38(33,34)26(15-18-35-19-16-26)25(32)31-37-24-5-1-2-17-36-24/h6-13,24H,1-5,14-19H2,(H,31,32) |
| InChIKey | AYPXZLVODIIVTG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|