C22H23F4NO5S — CID 58623090
1-ethyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylic acid (PubChem CID 58623090) has the molecular formula C22H23F4NO5S and a molecular weight of 489.49 g/mol. Its IUPAC name is 1-ethyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 1-ethyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58623090 |
| Molecular Formula | C22H23F4NO5S |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1-ethyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylic acid |
| SMILES | CCN1CCC(C(=O)O)(S(=O)(=O)c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H23F4NO5S/c1-2-27-13-11-21(12-14-27,20(28)29)33(30,31)18-9-5-16(6-10-18)15-3-7-17(8-4-15)32-22(25,26)19(23)24/h3-10,19H,2,11-14H2,1H3,(H,28,29) |
| InChIKey | YYQPLLWSEHZNNR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|