C31H33F4NO5S — CID 58623099
tert-butyl 1-benzyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623099) has the molecular formula C31H33F4NO5S and a molecular weight of 607.67 g/mol. Its IUPAC name is tert-butyl 1-benzyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-benzyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623099 |
| Molecular Formula | C31H33F4NO5S |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | tert-butyl 1-benzyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)cc2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H33F4NO5S/c1-29(2,3)41-28(37)30(17-19-36(20-18-30)21-22-7-5-4-6-8-22)42(38,39)26-15-11-24(12-16-26)23-9-13-25(14-10-23)40-31(34,35)27(32)33/h4-16,27H,17-21H2,1-3H3 |
| InChIKey | IRVLLTSIORAEMY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|