C22H23F3O5S — CID 58623100
4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid (PubChem CID 58623100) has the molecular formula C22H23F3O5S and a molecular weight of 456.48 g/mol. Its IUPAC name is 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid.
| Compound Name | 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid |
|---|---|
| PubChem CID | 58623100 |
| Molecular Formula | C22H23F3O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid |
| SMILES | O=C(O)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H23F3O5S/c23-22(24,25)11-1-2-16-3-5-17(6-4-16)18-7-9-19(10-8-18)31(28,29)21(20(26)27)12-14-30-15-13-21/h3-10H,1-2,11-15H2,(H,26,27) |
| InChIKey | AFNCHAXWQBSUMH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |