C24H28F5N3O4S — CID 58623106
tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623106) has the molecular formula C24H28F5N3O4S and a molecular weight of 549.56 g/mol. Its IUPAC name is tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623106 |
| Molecular Formula | C24H28F5N3O4S |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCNCC1 |
| InChI | InChI=1S/C24H28F5N3O4S/c1-21(2,3)36-20(33)22(10-12-30-13-11-22)37(34,35)18-6-4-16(5-7-18)19-15-31-17(14-32-19)8-9-23(25,26)24(27,28)29/h4-7,14-15,30H,8-13H2,1-3H3 |
| InChIKey | TYNYSIOVOPDGMI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|