C26H31F4NO5S — CID 58623110
tert-butyl 1-ethyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623110) has the molecular formula C26H31F4NO5S and a molecular weight of 545.60 g/mol. Its IUPAC name is tert-butyl 1-ethyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-ethyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623110 |
| Molecular Formula | C26H31F4NO5S |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | tert-butyl 1-ethyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCN1CCC(C(=O)OC(C)(C)C)(S(=O)(=O)c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H31F4NO5S/c1-5-31-16-14-25(15-17-31,23(32)36-24(2,3)4)37(33,34)21-12-8-19(9-13-21)18-6-10-20(11-7-18)35-26(29,30)22(27)28/h6-13,22H,5,14-17H2,1-4H3 |
| InChIKey | ANECUCWCMWZCHV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|