About tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate
tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate (PubChem CID 58623118) has the molecular formula C22H25F3O4S
and a molecular weight of 442.50 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate |
| PubChem CID | 58623118 |
| Molecular Formula | C22H25F3O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)c1ccc(-c2ccc(CCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H25F3O4S/c1-21(2,3)29-20(26)15-30(27,28)19-12-10-18(11-13-19)17-8-6-16(7-9-17)5-4-14-22(23,24)25/h6-13H,4-5,14-15H2,1-3H3 |
| InChIKey | JEMAVWYLOPBIGL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate?
The IUPAC name of tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate (CID 58623118) is tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate.
What is the SMILES notation for tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate?
The canonical SMILES for tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate is CC(C)(C)OC(=O)CS(=O)(=O)c1ccc(-c2ccc(CCCC(F)(F)F)cc2)cc1.
What is the InChIKey of tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate?
The InChIKey is JEMAVWYLOPBIGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F3O4S/c1-21(2,3)29-20(26)15-30(27,28)19-12-10-18(11-13-19)17-8-6-16(7-9-17)5-4-14-22(23,24)25/h6-13H,4-5,14-15H2,1-3H3.
What are the key properties of tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate?
tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate has a molecular weight of 442.50 g/mol, XLogP of 5.35, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylacetate is sourced from PubChem (CID 58623118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).