C26H32F5N3O4S — CID 58623121
tert-butyl 1-ethyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623121) has the molecular formula C26H32F5N3O4S and a molecular weight of 577.62 g/mol. Its IUPAC name is tert-butyl 1-ethyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-ethyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623121 |
| Molecular Formula | C26H32F5N3O4S |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | tert-butyl 1-ethyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCN1CCC(C(=O)OC(C)(C)C)(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C26H32F5N3O4S/c1-5-34-14-12-24(13-15-34,22(35)38-23(2,3)4)39(36,37)20-8-6-18(7-9-20)21-17-32-19(16-33-21)10-11-25(27,28)26(29,30)31/h6-9,16-17H,5,10-15H2,1-4H3 |
| InChIKey | OXPFHSUEKGFVKG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|