C22H25F5N4O6S — CID 58623139
N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 58623139) has the molecular formula C22H25F5N4O6S and a molecular weight of 568.52 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623139 |
| Molecular Formula | C22H25F5N4O6S |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3cnc(OCC(F)(F)C(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C22H25F5N4O6S/c1-36-11-10-31-8-6-20(7-9-31,19(32)30-33)38(34,35)16-4-2-15(3-5-16)17-12-29-18(13-28-17)37-14-21(23,24)22(25,26)27/h2-5,12-13,33H,6-11,14H2,1H3,(H,30,32) |
| InChIKey | PKVXRNBTAROSRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|