C23H25F5N2O4S — CID 58623144
1-ethyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylic acid (PubChem CID 58623144) has the molecular formula C23H25F5N2O4S and a molecular weight of 520.52 g/mol. Its IUPAC name is 1-ethyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 1-ethyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58623144 |
| Molecular Formula | C23H25F5N2O4S |
| Molecular Weight | 520.52 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 1-ethyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylic acid |
| SMILES | CCN1CCC(C(=O)O)(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C23H25F5N2O4S/c1-2-30-13-11-21(12-14-30,20(31)32)35(33,34)18-6-4-17(5-7-18)19-8-3-16(15-29-19)9-10-22(24,25)23(26,27)28/h3-8,15H,2,9-14H2,1H3,(H,31,32) |
| InChIKey | AFBCUGAIJOXLQY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|