C22H23F5O4S — CID 58623148
tert-butyl 2-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylacetate (PubChem CID 58623148) has the molecular formula C22H23F5O4S and a molecular weight of 478.48 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylacetate.
| Compound Name | tert-butyl 2-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 58623148 |
| Molecular Formula | C22H23F5O4S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | tert-butyl 2-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylacetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)c1ccc(-c2ccc(CCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H23F5O4S/c1-20(2,3)31-19(28)14-32(29,30)18-10-8-17(9-11-18)16-6-4-15(5-7-16)12-13-21(23,24)22(25,26)27/h4-11H,12-14H2,1-3H3 |
| InChIKey | MNYAUIXZFQAOLC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|