C29H34F5NO4S — CID 58623162
tert-butyl 1-cyclopropyl-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623162) has the molecular formula C29H34F5NO4S and a molecular weight of 587.65 g/mol. Its IUPAC name is tert-butyl 1-cyclopropyl-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-cyclopropyl-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623162 |
| Molecular Formula | C29H34F5NO4S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | tert-butyl 1-cyclopropyl-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C29H34F5NO4S/c1-26(2,3)39-25(36)27(16-18-35(19-17-27)23-10-11-23)40(37,38)24-12-8-22(9-13-24)21-6-4-20(5-7-21)14-15-28(30,31)29(32,33)34/h4-9,12-13,23H,10-11,14-19H2,1-3H3 |
| InChIKey | COCPPPLLHVBNQA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|