C19H18F5N3O6S — CID 58623180
N-hydroxy-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 58623180) has the molecular formula C19H18F5N3O6S and a molecular weight of 511.43 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 58623180 |
| Molecular Formula | C19H18F5N3O6S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | N-hydroxy-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3cnc(OCC(F)(F)C(F)(F)F)cn3)cc2)CCOCC1 |
| InChI | InChI=1S/C19H18F5N3O6S/c20-18(21,19(22,23)24)11-33-15-10-25-14(9-26-15)12-1-3-13(4-2-12)34(30,31)17(16(28)27-29)5-7-32-8-6-17/h1-4,9-10,29H,5-8,11H2,(H,27,28) |
| InChIKey | OSDGQPDWKJELEU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|