C22H21F5O5S — CID 58623197
4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid (PubChem CID 58623197) has the molecular formula C22H21F5O5S and a molecular weight of 492.46 g/mol. Its IUPAC name is 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid.
| Compound Name | 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid |
|---|---|
| PubChem CID | 58623197 |
| Molecular Formula | C22H21F5O5S |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylic acid |
| SMILES | O=C(O)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H21F5O5S/c23-21(24,22(25,26)27)10-9-15-1-3-16(4-2-15)17-5-7-18(8-6-17)33(30,31)20(19(28)29)11-13-32-14-12-20/h1-8H,9-14H2,(H,28,29) |
| InChIKey | AQGMTGDJFHGCEH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|