C17H23BrO5S — CID 58623208
2,2-dimethylpropyl 4-(4-bromophenyl)sulfonyloxane-4-carboxylate (PubChem CID 58623208) has the molecular formula C17H23BrO5S and a molecular weight of 419.34 g/mol. Its IUPAC name is 2,2-dimethylpropyl 4-(4-bromophenyl)sulfonyloxane-4-carboxylate.
| Compound Name | 2,2-dimethylpropyl 4-(4-bromophenyl)sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 58623208 |
| Molecular Formula | C17H23BrO5S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2,2-dimethylpropyl 4-(4-bromophenyl)sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)COC(=O)C1(S(=O)(=O)c2ccc(Br)cc2)CCOCC1 |
| InChI | InChI=1S/C17H23BrO5S/c1-16(2,3)12-23-15(19)17(8-10-22-11-9-17)24(20,21)14-6-4-13(18)5-7-14/h4-7H,8-12H2,1-3H3 |
| InChIKey | QLMNZEDYMGPVQZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |