C29H36F5NO5S — CID 58623212
tert-butyl 1-(2-methoxyethyl)-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623212) has the molecular formula C29H36F5NO5S and a molecular weight of 605.67 g/mol. Its IUPAC name is tert-butyl 1-(2-methoxyethyl)-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-(2-methoxyethyl)-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623212 |
| Molecular Formula | C29H36F5NO5S |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | tert-butyl 1-(2-methoxyethyl)-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | COCCN1CCC(C(=O)OC(C)(C)C)(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H36F5NO5S/c1-26(2,3)40-25(36)27(15-17-35(18-16-27)19-20-39-4)41(37,38)24-11-9-23(10-12-24)22-7-5-21(6-8-22)13-14-28(30,31)29(32,33)34/h5-12H,13-20H2,1-4H3 |
| InChIKey | BOLIUXOPCGJORP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|