About tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate
tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate (PubChem CID 58623213) has the molecular formula C26H32F2O5S
and a molecular weight of 494.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate |
| PubChem CID | 58623213 |
| Molecular Formula | C26H32F2O5S |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C26H32F2O5S/c1-25(2,3)33-24(29)26(15-17-32-18-16-26)34(30,31)22-13-11-21(12-14-22)20-9-7-19(8-10-20)5-4-6-23(27)28/h7-14,23H,4-6,15-18H2,1-3H3 |
| InChIKey | RVEUPEYSSYFCMC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate?
The IUPAC name of tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate (CID 58623213) is tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate?
The canonical SMILES for tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate is CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)F)cc3)cc2)CCOCC1.
What is the InChIKey of tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate?
The InChIKey is RVEUPEYSSYFCMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32F2O5S/c1-25(2,3)33-24(29)26(15-17-32-18-16-26)34(30,31)22-13-11-21(12-14-22)20-9-7-19(8-10-20)5-4-6-23(27)28/h7-14,23H,4-6,15-18H2,1-3H3.
What are the key properties of tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate?
tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate has a molecular weight of 494.60 g/mol, XLogP of 5.61, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate is sourced from PubChem (CID 58623213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).