C27H33F4NO6S — CID 58623219
tert-butyl 1-(2-methoxyethyl)-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623219) has the molecular formula C27H33F4NO6S and a molecular weight of 575.62 g/mol. Its IUPAC name is tert-butyl 1-(2-methoxyethyl)-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-(2-methoxyethyl)-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623219 |
| Molecular Formula | C27H33F4NO6S |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | tert-butyl 1-(2-methoxyethyl)-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | COCCN1CCC(C(=O)OC(C)(C)C)(S(=O)(=O)c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H33F4NO6S/c1-25(2,3)38-24(33)26(13-15-32(16-14-26)17-18-36-4)39(34,35)22-11-7-20(8-12-22)19-5-9-21(10-6-19)37-27(30,31)23(28)29/h5-12,23H,13-18H2,1-4H3 |
| InChIKey | SISHEYZDRVCHNX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|