C27H31F4NO5S — CID 58623244
tert-butyl 1-cyclopropyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623244) has the molecular formula C27H31F4NO5S and a molecular weight of 557.61 g/mol. Its IUPAC name is tert-butyl 1-cyclopropyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-cyclopropyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623244 |
| Molecular Formula | C27H31F4NO5S |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | tert-butyl 1-cyclopropyl-4-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(OC(F)(F)C(F)F)cc3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C27H31F4NO5S/c1-25(2,3)37-24(33)26(14-16-32(17-15-26)20-8-9-20)38(34,35)22-12-6-19(7-13-22)18-4-10-21(11-5-18)36-27(30,31)23(28)29/h4-7,10-13,20,23H,8-9,14-17H2,1-3H3 |
| InChIKey | CVYSSRZRIKIBFM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|