C27H30F5NO6S — CID 58623274
N-(oxan-2-yloxy)-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 58623274) has the molecular formula C27H30F5NO6S and a molecular weight of 591.60 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 58623274 |
| Molecular Formula | C27H30F5NO6S |
| Molecular Weight | 591.60 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | N-(oxan-2-yloxy)-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C27H30F5NO6S/c28-26(29,27(30,31)32)13-12-19-4-6-20(7-5-19)21-8-10-22(11-9-21)40(35,36)25(14-17-37-18-15-25)24(34)33-39-23-3-1-2-16-38-23/h4-11,23H,1-3,12-18H2,(H,33,34) |
| InChIKey | KLDFJECIPPWLNE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|