About 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide
1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide (PubChem CID 58623277) has the molecular formula C14H27NO3S
and a molecular weight of 289.44 g/mol. Its IUPAC name is 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide |
| PubChem CID | 58623277 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide |
| SMILES | CCCCS(=O)(=O)C1(C(=O)NC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H27NO3S/c1-5-6-11-19(17,18)14(12(16)15-4)9-7-13(2,3)8-10-14/h5-11H2,1-4H3,(H,15,16) |
| InChIKey | ZQKAVGJBXVWTDO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide?
The IUPAC name of 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide (CID 58623277) is 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide.
What is the SMILES notation for 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide?
The canonical SMILES for 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide is CCCCS(=O)(=O)C1(C(=O)NC)CCC(C)(C)CC1.
What is the InChIKey of 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide?
The InChIKey is ZQKAVGJBXVWTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3S/c1-5-6-11-19(17,18)14(12(16)15-4)9-7-13(2,3)8-10-14/h5-11H2,1-4H3,(H,15,16).
What are the key properties of 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide?
1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide has a molecular weight of 289.44 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfonyl-N,4,4-trimethylcyclohexane-1-carboxamide is sourced from PubChem (CID 58623277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).