About oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate
oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate (PubChem CID 58623290) has the molecular formula C28H34F2O6S
and a molecular weight of 536.64 g/mol. Its IUPAC name is oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate |
| PubChem CID | 58623290 |
| Molecular Formula | C28H34F2O6S |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate |
| SMILES | O=C(OCC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C28H34F2O6S/c29-26(30)6-3-4-21-7-9-22(10-8-21)23-11-13-25(14-12-23)37(32,33)28(15-18-34-19-16-28)27(31)36-20-24-5-1-2-17-35-24/h7-14,24,26H,1-6,15-20H2 |
| InChIKey | QNAQLPFWHAKJHX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate?
The IUPAC name of oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate (CID 58623290) is oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate.
What is the SMILES notation for oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate?
The canonical SMILES for oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate is O=C(OCC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)F)cc3)cc2)CCOCC1.
What is the InChIKey of oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate?
The InChIKey is QNAQLPFWHAKJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34F2O6S/c29-26(30)6-3-4-21-7-9-22(10-8-21)23-11-13-25(14-12-23)37(32,33)28(15-18-34-19-16-28)27(31)36-20-24-5-1-2-17-35-24/h7-14,24,26H,1-6,15-20H2.
What are the key properties of oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate?
oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate has a molecular weight of 536.64 g/mol, XLogP of 5.38, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyloxane-4-carboxylate is sourced from PubChem (CID 58623290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).