C24H22N5S3+ — CID 58623421
5,27-dithia-16,20-diaza-12-azoniaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1(28),2,4(12),6,8,10,21,23,25-nonaen-16-ylthiourea (PubChem CID 58623421) has the molecular formula C24H22N5S3+ and a molecular weight of 476.68 g/mol. Its IUPAC name is 5,27-dithia-16,20-diaza-12-azoniaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1(28),2,4(12),6,8,10,21,23,25-nonaen-16-ylthiourea.
| Compound Name | 5,27-dithia-16,20-diaza-12-azoniaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1(28),2,4(12),6,8,10,21,23,25-nonaen-16-ylthiourea |
|---|---|
| PubChem CID | 58623421 |
| Molecular Formula | C24H22N5S3+ |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 5,27-dithia-16,20-diaza-12-azoniaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1(28),2,4(12),6,8,10,21,23,25-nonaen-16-ylthiourea |
| SMILES | NC(=S)NN1C2CC[n+]3c(sc4ccccc43)C2=CC2=C3Sc4ccccc4N3CCC21 |
| InChI | InChI=1S/C24H21N5S3/c25-24(30)26-29-16-9-11-27-18-5-1-3-7-20(18)31-22(27)14(16)13-15-17(29)10-12-28-19-6-2-4-8-21(19)32-23(15)28/h1-8,13,16-17H,9-12H2,(H2-,25,26,30)/p+1 |
| InChIKey | PIQINSFEQAMHER-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 48.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|