About 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole]
2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole] (PubChem CID 58623512) has the molecular formula C15H12O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole].
Molecular Properties
| Compound Name | 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole] |
| PubChem CID | 58623512 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole] |
| SMILES | C1=CC=C2OC3(OC4=CC=CC=CC4O3)OC2C=C1 |
| InChI | InChI=1S/C15H12O4/c1-3-7-11-12(8-4-1)17-15(16-11)18-13-9-5-2-6-10-14(13)19-15/h1-11,13H |
| InChIKey | CYRJNOZTLFZQPE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole]?
The IUPAC name of 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole] (CID 58623512) is 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole].
What is the SMILES notation for 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole]?
The canonical SMILES for 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole] is C1=CC=C2OC3(OC4=CC=CC=CC4O3)OC2C=C1.
What is the InChIKey of 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole]?
The InChIKey is CYRJNOZTLFZQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O4/c1-3-7-11-12(8-4-1)17-15(16-11)18-13-9-5-2-6-10-14(13)19-15/h1-11,13H.
What are the key properties of 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole]?
2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole] has a molecular weight of 256.26 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2'-spirobi[3aH-cyclohepta[d][1,3]dioxole] is sourced from PubChem (CID 58623512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).