C19H32O16S2-2 — CID 58623519
[(3R,4S,6S)-5-hydroxy-2-(hydroxymethyl)-4-(methoxymethyl)-6-[[(3R,5R,8S)-3-(methoxymethyl)-4-sulfonatooxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]methoxymethyl]-2-methyloxan-3-yl] sulfate (PubChem CID 58623519) has the molecular formula C19H32O16S2-2 and a molecular weight of 580.58 g/mol. Its IUPAC name is [(3R,4S,6S)-5-hydroxy-2-(hydroxymethyl)-4-(methoxymethyl)-6-[[(3R,5R,8S)-3-(methoxymethyl)-4-sulfonatooxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]methoxymethyl]-2-methyloxan-3-yl] sulfate.
| Compound Name | [(3R,4S,6S)-5-hydroxy-2-(hydroxymethyl)-4-(methoxymethyl)-6-[[(3R,5R,8S)-3-(methoxymethyl)-4-sulfonatooxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]methoxymethyl]-2-methyloxan-3-yl] sulfate |
|---|---|
| PubChem CID | 58623519 |
| Molecular Formula | C19H32O16S2-2 |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | [(3R,4S,6S)-5-hydroxy-2-(hydroxymethyl)-4-(methoxymethyl)-6-[[(3R,5R,8S)-3-(methoxymethyl)-4-sulfonatooxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]methoxymethyl]-2-methyloxan-3-yl] sulfate |
| SMILES | COC[C@H]1OC2CO[C@@H](C1OS(=O)(=O)[O-])[C@H]2COC[C@@H]1OC(C)(CO)[C@H](OS(=O)(=O)[O-])[C@@H](COC)C1O |
| InChI | InChI=1S/C19H34O16S2/c1-19(9-20)18(35-37(25,26)27)11(4-28-2)15(21)13(33-19)7-30-5-10-12-8-31-16(10)17(34-36(22,23)24)14(32-12)6-29-3/h10-18,20-21H,4-9H2,1-3H3,(H,22,23,24)(H,25,26,27)/p-2/t10-,11-,12?,13-,14+,15?,16+,17?,18+,19?/m0/s1 |
| InChIKey | KEAPEXHWOOEMMW-MSPSXBROSA-L |
| XLogP | -3.10 |
| TPSA | 228.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|