C10H12ClFN5O3+ — CID 58623724
(2R,3R,4S,5R)-5-(6-amino-2-chloro-7H-purin-3-ium-3-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 58623724) has the molecular formula C10H12ClFN5O3+ and a molecular weight of 304.69 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-(6-amino-2-chloro-7H-purin-3-ium-3-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-5-(6-amino-2-chloro-7H-purin-3-ium-3-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 58623724 |
| Molecular Formula | C10H12ClFN5O3+ |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (2R,3R,4S,5R)-5-(6-amino-2-chloro-7H-purin-3-ium-3-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1nc(Cl)[n+]([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2F)c2nc[nH]c12 |
| InChI | InChI=1S/C10H11ClFN5O3/c11-10-16-7(13)5-8(15-2-14-5)17(10)9-4(12)6(19)3(1-18)20-9/h2-4,6,9,18-19H,1H2,(H2,13,14,15)/p+1/t3-,4+,6-,9-/m1/s1 |
| InChIKey | RVYOYQGCRLISGH-AYQXTPAHSA-O |
| XLogP | -0.93 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|