C23H30FNO — CID 58624058
1'-[[(1S,3S,6S)-3-bicyclo[4.3.1]dec-8-enyl]methyl]-5-fluorospiro[2H-1-benzofuran-3,4'-piperidine] (PubChem CID 58624058) has the molecular formula C23H30FNO and a molecular weight of 355.50 g/mol. Its IUPAC name is 1'-[[(1S,3S,6S)-3-bicyclo[4.3.1]dec-8-enyl]methyl]-5-fluorospiro[2H-1-benzofuran-3,4'-piperidine].
| Compound Name | 1'-[[(1S,3S,6S)-3-bicyclo[4.3.1]dec-8-enyl]methyl]-5-fluorospiro[2H-1-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 58624058 |
| Molecular Formula | C23H30FNO |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1'-[[(1S,3S,6S)-3-bicyclo[4.3.1]dec-8-enyl]methyl]-5-fluorospiro[2H-1-benzofuran-3,4'-piperidine] |
| SMILES | Fc1ccc2c(c1)C1(CCN(C[C@H]3CC[C@H]4CC=C[C@@H](C4)C3)CC1)CO2 |
| InChI | InChI=1S/C23H30FNO/c24-20-6-7-22-21(14-20)23(16-26-22)8-10-25(11-9-23)15-19-5-4-17-2-1-3-18(12-17)13-19/h1,3,6-7,14,17-19H,2,4-5,8-13,15-16H2/t17-,18+,19+/m1/s1 |
| InChIKey | BOIFYMBEGVVNBH-QYZOEREBSA-N |
| XLogP | 4.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|